C24H41NO2S — CID 91506671
(2R,3R,3aS,6aS)-3-[(3S)-3-hydroxyoct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91506671) has the molecular formula C24H41NO2S and a molecular weight of 407.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(3S)-3-hydroxyoct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(3S)-3-hydroxyoct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91506671 |
| Molecular Formula | C24H41NO2S |
| Molecular Weight | 407.66 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(3S)-3-hydroxyoct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1[C@H]2CC(CCSCCN3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C24H41NO2S/c1-2-3-4-7-21(26)8-9-22-23-17-19(16-20(23)18-24(22)27)10-14-28-15-13-25-11-5-6-12-25/h8-9,16,20-24,26-27H,2-7,10-15,17-18H2,1H3/t20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | XHOMAXAMULXCEC-OSFFKXSWSA-N |
| XLogP | 4.65 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.66 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|