C25H43NO2S — CID 90946671
(2R,3R,3aS,6aS)-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 90946671) has the molecular formula C25H43NO2S and a molecular weight of 421.69 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 90946671 |
| Molecular Formula | C25H43NO2S |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 421.30 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-(2-pyrrolidin-1-ylethylsulfanyl)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCSCCN3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO2S/c1-3-4-10-25(2,28)11-7-8-22-23-18-20(17-21(23)19-24(22)27)9-15-29-16-14-26-12-5-6-13-26/h7-8,17,21-24,27-28H,3-6,9-16,18-19H2,1-2H3/t21-,22+,23-,24+,25-/m0/s1 |
| InChIKey | RLMMZLCUSMQGPK-KKGFQHLNSA-N |
| XLogP | 5.04 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|