C22H37NO3 — CID 91353679
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanamide (PubChem CID 91353679) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanamide |
|---|---|
| PubChem CID | 91353679 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanamide |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCCCC(N)=O)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C22H37NO3/c1-3-4-11-22(2,26)12-7-9-18-19-14-16(8-5-6-10-21(23)25)13-17(19)15-20(18)24/h7,9,13,17-20,24,26H,3-6,8,10-12,14-15H2,1-2H3,(H2,23,25)/t17-,18+,19-,20+,22-/m0/s1 |
| InChIKey | NZQMPZYSSPAYQF-YWQQVWADSA-N |
| XLogP | 3.86 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|