C29H51NO3 — CID 91272940
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide (PubChem CID 91272940) has the molecular formula C29H51NO3 and a molecular weight of 461.73 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide |
|---|---|
| PubChem CID | 91272940 |
| Molecular Formula | C29H51NO3 |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.39 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCCCCC(=O)N(C(C)C)C(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H51NO3/c1-7-8-16-29(6,33)17-12-14-25-26-19-23(18-24(26)20-27(25)31)13-10-9-11-15-28(32)30(21(2)3)22(4)5/h12,14,18,21-22,24-27,31,33H,7-11,13,15-17,19-20H2,1-6H3/t24-,25+,26-,27+,29-/m0/s1 |
| InChIKey | XMFWHJKMNMWMOQ-XXWYYJBBSA-N |
| XLogP | 6.41 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|