C27H47NO4 — CID 90862483
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-di(propan-2-yl)propanamide (PubChem CID 90862483) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-di(propan-2-yl)propanamide.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 90862483 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-N,N-di(propan-2-yl)propanamide |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(COCCC(=O)N(C(C)C)C(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H47NO4/c1-7-8-12-27(6,31)13-9-10-23-24-16-21(15-22(24)17-25(23)29)18-32-14-11-26(30)28(19(2)3)20(4)5/h9-10,15,19-20,22-25,29,31H,7-8,11-14,16-18H2,1-6H3/t22-,23+,24-,25+,27-/m0/s1 |
| InChIKey | VPVXAZOHGAHLQY-OPTOMFAQSA-N |
| XLogP | 4.87 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|