C25H41NO4 — CID 90912274
2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 90912274) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 90912274 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCOCC(=O)N3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H41NO4/c1-3-4-10-25(2,29)11-7-8-21-22-16-19(15-20(22)17-23(21)27)9-14-30-18-24(28)26-12-5-6-13-26/h7-8,15,20-23,27,29H,3-6,9-14,16-18H2,1-2H3/t20-,21+,22-,23+,25-/m0/s1 |
| InChIKey | DYBKXPZYCMAWGG-XRTSLUGZSA-N |
| XLogP | 3.85 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|