C26H43NO3S — CID 90795597
2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]-1-piperidin-1-ylethanone (PubChem CID 90795597) has the molecular formula C26H43NO3S and a molecular weight of 449.70 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 90795597 |
| Molecular Formula | C26H43NO3S |
| Molecular Weight | 449.70 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]-1-piperidin-1-ylethanone |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCSCC(=O)N3CCCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H43NO3S/c1-3-4-11-26(2,30)12-8-9-22-23-17-20(16-21(23)18-24(22)28)10-15-31-19-25(29)27-13-6-5-7-14-27/h8-9,16,21-24,28,30H,3-7,10-15,17-19H2,1-2H3/t21-,22+,23-,24+,26-/m0/s1 |
| InChIKey | SSJZOJIFGOPZTO-YBTKJZEMSA-N |
| XLogP | 4.95 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|