C27H45NO3 — CID 91289190
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 91289190) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 91289190 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCCCCC(=O)N3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H45NO3/c1-3-4-14-27(2,31)15-10-12-23-24-19-21(18-22(24)20-25(23)29)11-6-5-7-13-26(30)28-16-8-9-17-28/h10,12,18,22-25,29,31H,3-9,11,13-17,19-20H2,1-2H3/t22-,23+,24-,25+,27-/m0/s1 |
| InChIKey | YDURNSDYTBNMDK-OPTOMFAQSA-N |
| XLogP | 5.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|