C25H43NO4 — CID 90991302
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(3-hydroxypropyl)pentanamide (PubChem CID 90991302) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(3-hydroxypropyl)pentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(3-hydroxypropyl)pentanamide |
|---|---|
| PubChem CID | 90991302 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(3-hydroxypropyl)pentanamide |
| SMILES | CCCC[C@](C)(O)CC=C[C@@H]1[C@H]2CC(CCCCC(=O)NCCCO)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H43NO4/c1-3-4-12-25(2,30)13-7-10-21-22-17-19(16-20(22)18-23(21)28)9-5-6-11-24(29)26-14-8-15-27/h7,10,16,20-23,27-28,30H,3-6,8-9,11-15,17-18H2,1-2H3,(H,26,29)/t20-,21+,22-,23+,25-/m0/s1 |
| InChIKey | YDGVKACLCHDRQQ-XRTSLUGZSA-N |
| XLogP | 3.88 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|