C27H38O4 — CID 10025502
methyl 4-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoate (PubChem CID 10025502) has the molecular formula C27H38O4 and a molecular weight of 426.60 g/mol. Its IUPAC name is methyl 4-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoate |
|---|---|
| PubChem CID | 10025502 |
| Molecular Formula | C27H38O4 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methyl 4-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]benzoate |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCc3ccc(C(=O)OC)cc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H38O4/c1-4-5-14-27(2,30)15-6-7-23-24-17-20(16-22(24)18-25(23)28)9-8-19-10-12-21(13-11-19)26(29)31-3/h6-7,10-13,16,22-25,28,30H,4-5,8-9,14-15,17-18H2,1-3H3/b7-6+/t22-,23+,24-,25+,27-/m0/s1 |
| InChIKey | FSASGRVDKNXBOD-XXWOYHMVSA-N |
| XLogP | 5.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|