C31H47NO2 — CID 21038057
(2R,3R,3aS,6aS)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-[3-(piperidin-1-ylmethyl)phenyl]ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038057) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-[3-(piperidin-1-ylmethyl)phenyl]ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-[3-(piperidin-1-ylmethyl)phenyl]ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038057 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(E,4S)-4-hydroxy-4-methyloct-1-enyl]-5-[2-[3-(piperidin-1-ylmethyl)phenyl]ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@](C)(O)C/C=C/[C@@H]1[C@H]2CC(CCc3cccc(CN4CCCCC4)c3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C31H47NO2/c1-3-4-15-31(2,34)16-9-12-28-29-21-25(20-27(29)22-30(28)33)14-13-24-10-8-11-26(19-24)23-32-17-6-5-7-18-32/h8-12,19-20,27-30,33-34H,3-7,13-18,21-23H2,1-2H3/b12-9+/t27-,28+,29-,30+,31-/m0/s1 |
| InChIKey | XDVHILCWIBOCRT-GZHOEQNGSA-N |
| XLogP | 6.44 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|