C28H41NO — CID 90890597
(2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(4-piperidin-1-ylbutyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 90890597) has the molecular formula C28H41NO and a molecular weight of 407.64 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(4-piperidin-1-ylbutyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(4-piperidin-1-ylbutyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 90890597 |
| Molecular Formula | C28H41NO |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.32 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(4-piperidin-1-ylbutyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CCCCN4CCCCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C28H41NO/c1-22-10-9-13-23(18-22)11-3-4-14-26-27-20-24(19-25(27)21-28(26)30)12-5-8-17-29-15-6-2-7-16-29/h4,9-10,13-14,18-19,25-28,30H,2-3,5-8,11-12,15-17,20-21H2,1H3/t25-,26+,27-,28+/m0/s1 |
| InChIKey | HJBKRLFZIKKLSB-ZVBOOHQUSA-N |
| XLogP | 6.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|