C28H41NO2 — CID 90925532
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide (PubChem CID 90925532) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 90925532 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-diethylpentanamide |
| SMILES | CCN(CC)C(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](C=CCCc3cccc(C)c3)[C@H]2C1 |
| InChI | InChI=1S/C28H41NO2/c1-4-29(5-2)28(31)16-9-7-13-23-18-24-20-27(30)25(26(24)19-23)15-8-6-12-22-14-10-11-21(3)17-22/h8,10-11,14-15,17-18,24-27,30H,4-7,9,12-13,16,19-20H2,1-3H3/t24-,25+,26-,27+/m0/s1 |
| InChIKey | JOEUBMOLPJAQCH-YYGZZXRFSA-N |
| XLogP | 5.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|