C32H49NO3 — CID 91409542
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dibutylpentanamide (PubChem CID 91409542) has the molecular formula C32H49NO3 and a molecular weight of 495.75 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dibutylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dibutylpentanamide |
|---|---|
| PubChem CID | 91409542 |
| Molecular Formula | C32H49NO3 |
| Molecular Weight | 495.75 g/mol |
| Exact Mass | 495.37 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dibutylpentanamide |
| SMILES | CCCCN(CCCC)C(=O)CCCCC1=C[C@H]2C[C@@H](O)[C@H](C=C[C@H](O)Cc3cccc(C)c3)[C@H]2C1 |
| InChI | InChI=1S/C32H49NO3/c1-4-6-17-33(18-7-5-2)32(36)14-9-8-12-26-20-27-23-31(35)29(30(27)22-26)16-15-28(34)21-25-13-10-11-24(3)19-25/h10-11,13,15-16,19-20,27-31,34-35H,4-9,12,14,17-18,21-23H2,1-3H3/t27-,28-,29+,30-,31+/m0/s1 |
| InChIKey | ZFDDLTTVMJKOEA-XVEIJSAGSA-N |
| XLogP | 6.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.75 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|