C28H39NO4 — CID 21038446
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylpentan-1-one (PubChem CID 21038446) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylpentan-1-one.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylpentan-1-one |
|---|---|
| PubChem CID | 21038446 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylpentan-1-one |
| SMILES | Cc1cccc(C[C@H](O)/C=C/[C@@H]2[C@H]3CC(CCCCC(=O)N4CCOCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C28H39NO4/c1-20-5-4-7-21(15-20)17-24(30)9-10-25-26-18-22(16-23(26)19-27(25)31)6-2-3-8-28(32)29-11-13-33-14-12-29/h4-5,7,9-10,15-16,23-27,30-31H,2-3,6,8,11-14,17-19H2,1H3/b10-9+/t23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | UGKOQKDOXDDOCV-NAGNNHFHSA-N |
| XLogP | 3.82 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|