C29H41NO4 — CID 21038848
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one (PubChem CID 21038848) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one |
|---|---|
| PubChem CID | 21038848 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one |
| SMILES | Cc1cccc(C[C@H](O)/C=C/[C@@H]2[C@H]3CC(CCCCCC(=O)N4CCOCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H41NO4/c1-21-6-5-8-22(16-21)18-25(31)10-11-26-27-19-23(17-24(27)20-28(26)32)7-3-2-4-9-29(33)30-12-14-34-15-13-30/h5-6,8,10-11,16-17,24-28,31-32H,2-4,7,9,12-15,18-20H2,1H3/b11-10+/t24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | BRUITIPMBOZJHF-GPIGDBTNSA-N |
| XLogP | 4.21 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|