C28H43NO2 — CID 21038946
(2R,3R,3aS,6aS)-5-[5-(diethylamino)pentyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038946) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(diethylamino)pentyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(diethylamino)pentyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038946 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(diethylamino)pentyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCN(CC)CCCCCC1=C[C@H]2C[C@@H](O)[C@H](/C=C/[C@H](O)Cc3cccc(C)c3)[C@H]2C1 |
| InChI | InChI=1S/C28H43NO2/c1-4-29(5-2)15-8-6-7-11-23-17-24-20-28(31)26(27(24)19-23)14-13-25(30)18-22-12-9-10-21(3)16-22/h9-10,12-14,16-17,24-28,30-31H,4-8,11,15,18-20H2,1-3H3/b14-13+/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | VCHIUTOALFPCET-SPEKVCQASA-N |
| XLogP | 5.30 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|