C30H45NO2 — CID 91252688
(2R,3R,3aS,6aS)-3-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-(6-piperidin-1-ylhexyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91252688) has the molecular formula C30H45NO2 and a molecular weight of 451.70 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-(6-piperidin-1-ylhexyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-(6-piperidin-1-ylhexyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91252688 |
| Molecular Formula | C30H45NO2 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 451.35 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-(6-piperidin-1-ylhexyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(C[C@@H](O)C=C[C@@H]2[C@H]3CC(CCCCCCN4CCCCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C30H45NO2/c1-23-10-9-12-24(18-23)20-27(32)13-14-28-29-21-25(19-26(29)22-30(28)33)11-5-2-3-6-15-31-16-7-4-8-17-31/h9-10,12-14,18-19,26-30,32-33H,2-8,11,15-17,20-22H2,1H3/t26-,27-,28+,29-,30+/m0/s1 |
| InChIKey | JSLUJCAEJXUORM-FVYAUOJASA-N |
| XLogP | 5.83 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|