C28H42N2O2 — CID 21038143
(2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-[2-(2-piperidin-1-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038143) has the molecular formula C28H42N2O2 and a molecular weight of 438.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-[2-(2-piperidin-1-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-[2-(2-piperidin-1-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038143 |
| Molecular Formula | C28H42N2O2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.32 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-5-[2-(2-piperidin-1-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(C[C@@H](O)/C=C/[C@@H]2[C@H]3CC(CCNCCN4CCCCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C28H42N2O2/c1-21-6-5-7-22(16-21)18-25(31)8-9-26-27-19-23(17-24(27)20-28(26)32)10-11-29-12-15-30-13-3-2-4-14-30/h5-9,16-17,24-29,31-32H,2-4,10-15,18-20H2,1H3/b9-8+/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | RPCXPXGBGJVWKF-FLZTXUGZSA-N |
| XLogP | 3.86 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|