C29H41NO3 — CID 91447678
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one (PubChem CID 91447678) has the molecular formula C29H41NO3 and a molecular weight of 451.65 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one |
|---|---|
| PubChem CID | 91447678 |
| Molecular Formula | C29H41NO3 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-morpholin-4-ylhexan-1-one |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CCCCCC(=O)N4CCOCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H41NO3/c1-22-8-7-11-23(18-22)9-5-6-12-26-27-20-24(19-25(27)21-28(26)31)10-3-2-4-13-29(32)30-14-16-33-17-15-30/h6-8,11-12,18-19,25-28,31H,2-5,9-10,13-17,20-21H2,1H3/t25-,26+,27-,28+/m0/s1 |
| InChIKey | DHRRPWBOWREISV-ZVBOOHQUSA-N |
| XLogP | 5.24 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|