C27H37NO4 — CID 91052993
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one (PubChem CID 91052993) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 91052993 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(COCCC(=O)N4CCOCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H37NO4/c1-20-5-4-7-21(15-20)6-2-3-8-24-25-17-22(16-23(25)18-26(24)29)19-32-12-9-27(30)28-10-13-31-14-11-28/h3-5,7-8,15-16,23-26,29H,2,6,9-14,17-19H2,1H3/t23-,24+,25-,26+/m0/s1 |
| InChIKey | HUDKTFRSWUSWGN-ROXDYWFKSA-N |
| XLogP | 3.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|