C23H31NO2 — CID 21038283
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide (PubChem CID 21038283) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide |
|---|---|
| PubChem CID | 21038283 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]butanamide |
| SMILES | Cc1cccc(CC/C=C/[C@@H]2[C@H]3CC(CCCC(N)=O)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C23H31NO2/c1-16-6-4-8-17(12-16)7-2-3-10-20-21-14-18(9-5-11-23(24)26)13-19(21)15-22(20)25/h3-4,6,8,10,12-13,19-22,25H,2,5,7,9,11,14-15H2,1H3,(H2,24,26)/b10-3+/t19-,20+,21-,22+/m0/s1 |
| InChIKey | YKMOPWZLMQSEGI-YLTSBHLTSA-N |
| XLogP | 4.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|