C26H38N2O2 — CID 21038136
3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-N,N-dimethylpropanamide (PubChem CID 21038136) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-N,N-dimethylpropanamide.
| Compound Name | 3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 21038136 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E)-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-N,N-dimethylpropanamide |
| SMILES | Cc1cccc(CC/C=C/[C@@H]2[C@H]3CC(CCNCCC(=O)N(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C26H38N2O2/c1-19-7-6-9-20(15-19)8-4-5-10-23-24-17-21(16-22(24)18-25(23)29)11-13-27-14-12-26(30)28(2)3/h5-7,9-10,15-16,22-25,27,29H,4,8,11-14,17-18H2,1-3H3/b10-5+/t22-,23+,24-,25+/m0/s1 |
| InChIKey | GNAQOWPESWGYRO-FTHOKTIUSA-N |
| XLogP | 3.89 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|