C31H47NO2 — CID 91321345
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide (PubChem CID 91321345) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide |
|---|---|
| PubChem CID | 91321345 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-di(propan-2-yl)hexanamide |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CCCCCC(=O)N(C(C)C)C(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C31H47NO2/c1-22(2)32(23(3)4)31(34)17-8-6-7-14-26-19-27-21-30(33)28(29(27)20-26)16-10-9-13-25-15-11-12-24(5)18-25/h10-12,15-16,18-19,22-23,27-30,33H,6-9,13-14,17,20-21H2,1-5H3/t27-,28+,29-,30+/m0/s1 |
| InChIKey | WKNOHRRSPNXCSC-RRGQHJHPSA-N |
| XLogP | 7.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|