C29H44N2O2 — CID 91044695
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylamino]-N,N-di(propan-2-yl)propanamide (PubChem CID 91044695) has the molecular formula C29H44N2O2 and a molecular weight of 452.68 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylamino]-N,N-di(propan-2-yl)propanamide.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylamino]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 91044695 |
| Molecular Formula | C29H44N2O2 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.34 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methylamino]-N,N-di(propan-2-yl)propanamide |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CNCCC(=O)N(C(C)C)C(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H44N2O2/c1-20(2)31(21(3)4)29(33)13-14-30-19-24-16-25-18-28(32)26(27(25)17-24)12-7-6-10-23-11-8-9-22(5)15-23/h7-9,11-12,15-16,20-21,25-28,30,32H,6,10,13-14,17-19H2,1-5H3/t25-,26+,27-,28+/m0/s1 |
| InChIKey | QBSHJEVLRWXPLT-ZVBOOHQUSA-N |
| XLogP | 5.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|