C29H46N2O2 — CID 21039320
(2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039320) has the molecular formula C29H46N2O2 and a molecular weight of 454.70 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039320 |
| Molecular Formula | C29H46N2O2 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.36 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[[3-[di(propan-2-yl)amino]propylamino]methyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(C[C@@H](O)/C=C/[C@@H]2[C@H]3CC(CNCCCN(C(C)C)C(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H46N2O2/c1-20(2)31(21(3)4)13-7-12-30-19-24-15-25-18-29(33)27(28(25)17-24)11-10-26(32)16-23-9-6-8-22(5)14-23/h6,8-11,14-15,20-21,25-30,32-33H,7,12-13,16-19H2,1-5H3/b11-10+/t25-,26-,27+,28-,29+/m0/s1 |
| InChIKey | DBQKEGQQOOYASA-BJOLXNHHSA-N |
| XLogP | 4.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|