C25H37NO3 — CID 21038324
(2R,3R,3aS,6aS)-5-[3-(dimethylamino)propoxymethyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038324) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propoxymethyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propoxymethyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038324 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propoxymethyl]-3-[(E,3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(C[C@@H](O)/C=C/[C@@H]2[C@H]3CC(COCCCN(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C25H37NO3/c1-18-6-4-7-19(12-18)14-22(27)8-9-23-24-15-20(13-21(24)16-25(23)28)17-29-11-5-10-26(2)3/h4,6-9,12-13,21-25,27-28H,5,10-11,14-17H2,1-3H3/b9-8+/t21-,22-,23+,24-,25+/m0/s1 |
| InChIKey | ZXWCBOZHJQVPAZ-QDDMXOPASA-N |
| XLogP | 3.37 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|