C29H43NO4 — CID 91238399
2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-di(propan-2-yl)acetamide (PubChem CID 91238399) has the molecular formula C29H43NO4 and a molecular weight of 469.67 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 91238399 |
| Molecular Formula | C29H43NO4 |
| Molecular Weight | 469.67 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethoxy]-N,N-di(propan-2-yl)acetamide |
| SMILES | Cc1cccc(C[C@@H](O)C=C[C@@H]2[C@H]3CC(CCOCC(=O)N(C(C)C)C(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H43NO4/c1-19(2)30(20(3)4)29(33)18-34-12-11-23-14-24-17-28(32)26(27(24)16-23)10-9-25(31)15-22-8-6-7-21(5)13-22/h6-10,13-14,19-20,24-28,31-32H,11-12,15-18H2,1-5H3/t24-,25-,26+,27-,28+/m0/s1 |
| InChIKey | HARLCHCEQBSDSH-AJIIGFCHSA-N |
| XLogP | 4.45 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.67 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|