C29H45NO3 — CID 21038302
(2R,3R,3aS,6aS)-5-[3-[di(propan-2-yl)amino]propoxymethyl]-3-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038302) has the molecular formula C29H45NO3 and a molecular weight of 455.68 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[3-[di(propan-2-yl)amino]propoxymethyl]-3-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[3-[di(propan-2-yl)amino]propoxymethyl]-3-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038302 |
| Molecular Formula | C29H45NO3 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[3-[di(propan-2-yl)amino]propoxymethyl]-3-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(C[C@H](O)/C=C/[C@@H]2[C@H]3CC(COCCCN(C(C)C)C(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C29H45NO3/c1-20(2)30(21(3)4)12-7-13-33-19-24-15-25-18-29(32)27(28(25)17-24)11-10-26(31)16-23-9-6-8-22(5)14-23/h6,8-11,14-15,20-21,25-29,31-32H,7,12-13,16-19H2,1-5H3/b11-10+/t25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | LQEGLUOBMGEZAS-HRZDNXAHSA-N |
| XLogP | 4.92 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|