C27H37NO5 — CID 90915190
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one (PubChem CID 90915190) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 90915190 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
| SMILES | Cc1cccc(C[C@@H](O)C=C[C@@H]2[C@H]3CC(COCCC(=O)N4CCOCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H37NO5/c1-19-3-2-4-20(13-19)15-23(29)5-6-24-25-16-21(14-22(25)17-26(24)30)18-33-10-7-27(31)28-8-11-32-12-9-28/h2-6,13-14,22-26,29-30H,7-12,15-18H2,1H3/t22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | BQUWBTYUTNFXAL-HEXNFIEUSA-N |
| XLogP | 2.66 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|