C26H43NO5 — CID 21038084
3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one (PubChem CID 21038084) has the molecular formula C26H43NO5 and a molecular weight of 449.63 g/mol. Its IUPAC name is 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 21038084 |
| Molecular Formula | C26H43NO5 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.31 |
| IUPAC Name | 3-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methoxy]-1-morpholin-4-ylpropan-1-one |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(COCCC(=O)N3CCOCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H43NO5/c1-3-4-5-19(2)14-22(28)6-7-23-24-16-20(15-21(24)17-25(23)29)18-32-11-8-26(30)27-9-12-31-13-10-27/h6-7,15,19,21-25,28-29H,3-5,8-14,16-18H2,1-2H3/b7-6+/t19-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | XDCQGFJQOXZXHK-PUPGROASSA-N |
| XLogP | 3.33 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|