C26H45NO3S — CID 91590278
(2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(3-morpholin-4-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91590278) has the molecular formula C26H45NO3S and a molecular weight of 451.72 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(3-morpholin-4-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(3-morpholin-4-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91590278 |
| Molecular Formula | C26H45NO3S |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(3-morpholin-4-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CSCCCN3CCOCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H45NO3S/c1-3-4-6-20(2)15-23(28)7-8-24-25-17-21(16-22(25)18-26(24)29)19-31-14-5-9-27-10-12-30-13-11-27/h7-8,16,20,22-26,28-29H,3-6,9-15,17-19H2,1-2H3/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | QUGHYVKBDJCCIQ-MFJVRWMJSA-N |
| XLogP | 4.52 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|