C29H51NO3 — CID 91443628
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dipropylpentanamide (PubChem CID 91443628) has the molecular formula C29H51NO3 and a molecular weight of 461.73 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dipropylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dipropylpentanamide |
|---|---|
| PubChem CID | 91443628 |
| Molecular Formula | C29H51NO3 |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 461.39 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N,N-dipropylpentanamide |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCCCC(=O)N(CCC)CCC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H51NO3/c1-5-8-11-22(4)18-25(31)14-15-26-27-20-23(19-24(27)21-28(26)32)12-9-10-13-29(33)30(16-6-2)17-7-3/h14-15,19,22,24-28,31-32H,5-13,16-18,20-21H2,1-4H3/t22-,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | RZCQMLAWWVHOCS-RPXGRCMXSA-N |
| XLogP | 6.27 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|