C27H47NO4 — CID 91003973
methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentylamino]propanoate (PubChem CID 91003973) has the molecular formula C27H47NO4 and a molecular weight of 449.68 g/mol. Its IUPAC name is methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentylamino]propanoate.
| Compound Name | methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentylamino]propanoate |
|---|---|
| PubChem CID | 91003973 |
| Molecular Formula | C27H47NO4 |
| Molecular Weight | 449.68 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | methyl 3-[5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentylamino]propanoate |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCCCCNCCC(=O)OC)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H47NO4/c1-4-5-9-20(2)16-23(29)11-12-24-25-18-21(17-22(25)19-26(24)30)10-7-6-8-14-28-15-13-27(31)32-3/h11-12,17,20,22-26,28-30H,4-10,13-16,18-19H2,1-3H3/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | KGUNCCGKWXCCKW-MFJVRWMJSA-N |
| XLogP | 4.78 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|