C25H46N2O2 — CID 91234132
(2R,3R,3aS,6aS)-5-[2-[3-(dimethylamino)propylamino]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91234132) has the molecular formula C25H46N2O2 and a molecular weight of 406.66 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[2-[3-(dimethylamino)propylamino]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[2-[3-(dimethylamino)propylamino]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91234132 |
| Molecular Formula | C25H46N2O2 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[2-[3-(dimethylamino)propylamino]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCNCCCN(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H46N2O2/c1-5-6-8-19(2)15-22(28)9-10-23-24-17-20(16-21(24)18-25(23)29)11-13-26-12-7-14-27(3)4/h9-10,16,19,21-26,28-29H,5-8,11-15,17-18H2,1-4H3/t19-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | LTOADWKLJLIULO-IESFANJTSA-N |
| XLogP | 3.99 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|