C26H46N2O3 — CID 21038117
(2R,3R,3aS,6aS)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038117) has the molecular formula C26H46N2O3 and a molecular weight of 434.67 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038117 |
| Molecular Formula | C26H46N2O3 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.35 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-[2-(2-morpholin-4-ylethylamino)ethyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCNCCN3CCOCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H46N2O3/c1-3-4-5-20(2)16-23(29)6-7-24-25-18-21(17-22(25)19-26(24)30)8-9-27-10-11-28-12-14-31-15-13-28/h6-7,17,20,22-27,29-30H,3-5,8-16,18-19H2,1-2H3/b7-6+/t20-,22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | LPHPVWHUWFEXJU-BIKIUOCQSA-N |
| XLogP | 3.38 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|