C28H47NO3 — CID 91411122
6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one (PubChem CID 91411122) has the molecular formula C28H47NO3 and a molecular weight of 445.69 g/mol. Its IUPAC name is 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one.
| Compound Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one |
|---|---|
| PubChem CID | 91411122 |
| Molecular Formula | C28H47NO3 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.36 |
| IUPAC Name | 6-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-ylhexan-1-one |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCCCCC(=O)N3CCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C28H47NO3/c1-3-4-10-21(2)17-24(30)13-14-25-26-19-22(18-23(26)20-27(25)31)11-6-5-7-12-28(32)29-15-8-9-16-29/h13-14,18,21,23-27,30-31H,3-12,15-17,19-20H2,1-2H3/t21-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | JDXLRAUBHDPHSX-UBEUYVGOSA-N |
| XLogP | 5.64 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|