C25H45NO3 — CID 90846116
(2R,3R,3aS,6aS)-5-[5-(2-hydroxyethylamino)pentyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 90846116) has the molecular formula C25H45NO3 and a molecular weight of 407.64 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(2-hydroxyethylamino)pentyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(2-hydroxyethylamino)pentyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 90846116 |
| Molecular Formula | C25H45NO3 |
| Molecular Weight | 407.64 g/mol |
| Exact Mass | 407.34 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(2-hydroxyethylamino)pentyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCCCCNCCO)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C25H45NO3/c1-3-4-8-19(2)15-22(28)10-11-23-24-17-20(16-21(24)18-25(23)29)9-6-5-7-12-26-13-14-27/h10-11,16,19,21-29H,3-9,12-15,17-18H2,1-2H3/t19-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | KKWHFVLKLWICLT-IESFANJTSA-N |
| XLogP | 4.21 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|