C29H53NO2 — CID 21039259
(2R,3R,3aS,6aS)-5-[6-[tert-butyl(methyl)amino]hexyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039259) has the molecular formula C29H53NO2 and a molecular weight of 447.75 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[6-[tert-butyl(methyl)amino]hexyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[6-[tert-butyl(methyl)amino]hexyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039259 |
| Molecular Formula | C29H53NO2 |
| Molecular Weight | 447.75 g/mol |
| Exact Mass | 447.41 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[6-[tert-butyl(methyl)amino]hexyl]-3-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCCCN(C)C(C)(C)C)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H53NO2/c1-7-8-13-22(2)18-25(31)15-16-26-27-20-23(19-24(27)21-28(26)32)14-11-9-10-12-17-30(6)29(3,4)5/h15-16,19,22,24-28,31-32H,7-14,17-18,20-21H2,1-6H3/b16-15+/t22-,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | LLPRTVZDKUHHBD-SXDAADQQSA-N |
| XLogP | 6.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|