C28H49NO2 — CID 91290407
(2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(5-piperidin-1-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91290407) has the molecular formula C28H49NO2 and a molecular weight of 431.71 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(5-piperidin-1-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(5-piperidin-1-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91290407 |
| Molecular Formula | C28H49NO2 |
| Molecular Weight | 431.71 g/mol |
| Exact Mass | 431.38 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-5-(5-piperidin-1-ylpentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCCCCN3CCCCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C28H49NO2/c1-3-4-11-22(2)18-25(30)13-14-26-27-20-23(19-24(27)21-28(26)31)12-7-5-8-15-29-16-9-6-10-17-29/h13-14,19,22,24-28,30-31H,3-12,15-18,20-21H2,1-2H3/t22-,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | PEUITAJNIBHHIM-RPXGRCMXSA-N |
| XLogP | 6.11 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|