C26H44N2O4 — CID 21038158
2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-1-morpholin-4-ylethanone (PubChem CID 21038158) has the molecular formula C26H44N2O4 and a molecular weight of 448.65 g/mol. Its IUPAC name is 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 21038158 |
| Molecular Formula | C26H44N2O4 |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | 2-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylamino]-1-morpholin-4-ylethanone |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCNCC(=O)N3CCOCC3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H44N2O4/c1-3-4-5-19(2)14-22(29)6-7-23-24-16-20(15-21(24)17-25(23)30)8-9-27-18-26(31)28-10-12-32-13-11-28/h6-7,15,19,21-25,27,29-30H,3-5,8-14,16-18H2,1-2H3/b7-6+/t19-,21-,22+,23+,24-,25+/m0/s1 |
| InChIKey | KLRRBOREGUHKOF-PUPGROASSA-N |
| XLogP | 2.90 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|