C30H45NO3 — CID 21038501
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-benzylpentanamide (PubChem CID 21038501) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-benzylpentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-benzylpentanamide |
|---|---|
| PubChem CID | 21038501 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-benzylpentanamide |
| SMILES | CCCC[C@H](C)C[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)NCc3ccccc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C30H45NO3/c1-3-4-10-22(2)17-26(32)15-16-27-28-19-24(18-25(28)20-29(27)33)13-8-9-14-30(34)31-21-23-11-6-5-7-12-23/h5-7,11-12,15-16,18,22,25-29,32-33H,3-4,8-10,13-14,17,19-21H2,1-2H3,(H,31,34)/b16-15+/t22-,25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | LYIVAJNFKSLIFB-ZTRUAMDVSA-N |
| XLogP | 5.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|