C27H40N2O3 — CID 91209350
5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(pyridin-4-ylmethyl)pentanamide (PubChem CID 91209350) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(pyridin-4-ylmethyl)pentanamide.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(pyridin-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 91209350 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(3R)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-N-(pyridin-4-ylmethyl)pentanamide |
| SMILES | CCCCC[C@@H](O)C=C[C@@H]1[C@H]2CC(CCCCC(=O)NCc3ccncc3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H40N2O3/c1-2-3-4-8-23(30)10-11-24-25-17-21(16-22(25)18-26(24)31)7-5-6-9-27(32)29-19-20-12-14-28-15-13-20/h10-16,22-26,30-31H,2-9,17-19H2,1H3,(H,29,32)/t22-,23+,24+,25-,26+/m0/s1 |
| InChIKey | PBPKGHGELOQHSZ-FMTGGWRCSA-N |
| XLogP | 4.70 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|