C27H41NO2 — CID 91146180
(2R,3R,3aS,6aS)-5-[2-[3-(aminomethyl)phenyl]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91146180) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[2-[3-(aminomethyl)phenyl]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[2-[3-(aminomethyl)phenyl]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91146180 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[2-[3-(aminomethyl)phenyl]ethyl]-3-[(3S,5S)-3-hydroxy-5-methylnon-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | CCCC[C@H](C)C[C@H](O)C=C[C@@H]1[C@H]2CC(CCc3cccc(CN)c3)=C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C27H41NO2/c1-3-4-6-19(2)13-24(29)11-12-25-26-16-21(15-23(26)17-27(25)30)10-9-20-7-5-8-22(14-20)18-28/h5,7-8,11-12,14-15,19,23-27,29-30H,3-4,6,9-10,13,16-18,28H2,1-2H3/t19-,23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | OFFWIIIDERURDT-CULAQTAASA-N |
| XLogP | 5.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|