C27H35NO3S — CID 21037963
4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-yl-4-sulfanylidenebutan-1-one (PubChem CID 21037963) has the molecular formula C27H35NO3S and a molecular weight of 453.65 g/mol. Its IUPAC name is 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-yl-4-sulfanylidenebutan-1-one.
| Compound Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-yl-4-sulfanylidenebutan-1-one |
|---|---|
| PubChem CID | 21037963 |
| Molecular Formula | C27H35NO3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 4-[(3aS,5R,6R,6aS)-5-hydroxy-6-[(E,3S)-3-hydroxy-4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]-1-pyrrolidin-1-yl-4-sulfanylidenebutan-1-one |
| SMILES | Cc1cccc(C[C@H](O)/C=C/[C@@H]2[C@H]3CC(C(=S)CCC(=O)N4CCCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H35NO3S/c1-18-5-4-6-19(13-18)14-22(29)7-8-23-24-16-21(15-20(24)17-25(23)30)26(32)9-10-27(31)28-11-2-3-12-28/h4-8,13,15,20,22-25,29-30H,2-3,9-12,14,16-17H2,1H3/b8-7+/t20-,22+,23+,24-,25+/m0/s1 |
| InChIKey | CKDFRPJPWYEDQU-YVZLDNLHSA-N |
| XLogP | 4.17 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|