C27H41NO — CID 21039033
(2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-5-(3-methylphenyl)pent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21039033) has the molecular formula C27H41NO and a molecular weight of 395.63 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-5-(3-methylphenyl)pent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-5-(3-methylphenyl)pent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21039033 |
| Molecular Formula | C27H41NO |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 395.32 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[5-(dimethylamino)pentyl]-3-[(E)-5-(3-methylphenyl)pent-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(CCC/C=C/[C@@H]2[C@H]3CC(CCCCCN(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H41NO/c1-21-11-10-14-22(17-21)12-6-4-8-15-25-26-19-23(18-24(26)20-27(25)29)13-7-5-9-16-28(2)3/h8,10-11,14-15,17-18,24-27,29H,4-7,9,12-13,16,19-20H2,1-3H3/b15-8+/t24-,25+,26-,27+/m0/s1 |
| InChIKey | CDPVGMXLUBNQHG-FUPSCGTNSA-N |
| XLogP | 5.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|