C25H37NOS — CID 21038335
(2R,3R,3aS,6aS)-5-[3-(dimethylamino)propylsulfanylmethyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 21038335) has the molecular formula C25H37NOS and a molecular weight of 399.64 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propylsulfanylmethyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propylsulfanylmethyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 21038335 |
| Molecular Formula | C25H37NOS |
| Molecular Weight | 399.64 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | (2R,3R,3aS,6aS)-5-[3-(dimethylamino)propylsulfanylmethyl]-3-[(E)-4-(3-methylphenyl)but-1-enyl]-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(CC/C=C/[C@@H]2[C@H]3CC(CSCCCN(C)C)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C25H37NOS/c1-19-8-6-10-20(14-19)9-4-5-11-23-24-16-21(15-22(24)17-25(23)27)18-28-13-7-12-26(2)3/h5-6,8,10-11,14-15,22-25,27H,4,7,9,12-13,16-18H2,1-3H3/b11-5+/t22-,23+,24-,25+/m0/s1 |
| InChIKey | OOMXIJOSVOHISL-ZASSXSICSA-N |
| XLogP | 5.11 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|