C27H39NOS — CID 91339818
(2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(3-pyrrolidin-1-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 91339818) has the molecular formula C27H39NOS and a molecular weight of 425.68 g/mol. Its IUPAC name is (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(3-pyrrolidin-1-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(3-pyrrolidin-1-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 91339818 |
| Molecular Formula | C27H39NOS |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (2R,3R,3aS,6aS)-3-[4-(3-methylphenyl)but-1-enyl]-5-(3-pyrrolidin-1-ylpropylsulfanylmethyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CSCCCN4CCCC4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H39NOS/c1-21-8-6-10-22(16-21)9-2-3-11-25-26-18-23(17-24(26)19-27(25)29)20-30-15-7-14-28-12-4-5-13-28/h3,6,8,10-11,16-17,24-27,29H,2,4-5,7,9,12-15,18-20H2,1H3/t24-,25+,26-,27+/m0/s1 |
| InChIKey | KAHUNYDRWGZQLL-YYGZZXRFSA-N |
| XLogP | 5.65 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|