C33H41NO2 — CID 91530189
[3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 91530189) has the molecular formula C33H41NO2 and a molecular weight of 483.70 g/mol. Its IUPAC name is [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 91530189 |
| Molecular Formula | C33H41NO2 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | [3-[2-[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(CCc4cccc(C(=O)N5CCCCC5)c4)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C33H41NO2/c1-24-9-7-11-25(19-24)10-3-4-14-30-31-22-27(21-29(31)23-32(30)35)16-15-26-12-8-13-28(20-26)33(36)34-17-5-2-6-18-34/h4,7-9,11-14,19-21,29-32,35H,2-3,5-6,10,15-18,22-23H2,1H3/t29-,30+,31-,32+/m0/s1 |
| InChIKey | MHNCVCGTAFAULC-MLMSKLGMSA-N |
| XLogP | 6.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|