C27H31NO2 — CID 91534451
2-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzamide (PubChem CID 91534451) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzamide.
| Compound Name | 2-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91534451 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[[(3aS,5R,6R,6aS)-5-hydroxy-6-[4-(3-methylphenyl)but-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]methyl]benzamide |
| SMILES | Cc1cccc(CCC=C[C@@H]2[C@H]3CC(Cc4ccccc4C(N)=O)=C[C@H]3C[C@H]2O)c1 |
| InChI | InChI=1S/C27H31NO2/c1-18-7-6-9-19(13-18)8-2-4-12-24-25-16-20(15-22(25)17-26(24)29)14-21-10-3-5-11-23(21)27(28)30/h3-7,9-13,15,22,24-26,29H,2,8,14,16-17H2,1H3,(H2,28,30)/t22-,24+,25-,26+/m0/s1 |
| InChIKey | XIDYFSJASQLZHS-RFRHCEIRSA-N |
| XLogP | 4.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|